C16H21N3O2 — CID 110145920
(3S,4S)-1-(1H-imidazol-2-ylmethyl)-3-methyl-4-phenoxypiperidin-3-ol (PubChem CID 110145920) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3S,4S)-1-(1H-imidazol-2-ylmethyl)-3-methyl-4-phenoxypiperidin-3-ol.
| Compound Name | (3S,4S)-1-(1H-imidazol-2-ylmethyl)-3-methyl-4-phenoxypiperidin-3-ol |
|---|---|
| PubChem CID | 110145920 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (3S,4S)-1-(1H-imidazol-2-ylmethyl)-3-methyl-4-phenoxypiperidin-3-ol |
| SMILES | C[C@]1(O)CN(Cc2ncc[nH]2)CC[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C16H21N3O2/c1-16(20)12-19(11-15-17-8-9-18-15)10-7-14(16)21-13-5-3-2-4-6-13/h2-6,8-9,14,20H,7,10-12H2,1H3,(H,17,18)/t14-,16-/m0/s1 |
| InChIKey | HUFNLYBJQUOSTB-HOCLYGCPSA-N |
| XLogP | 1.81 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |