C18H21FN2O2 — CID 110145924
(3S,4S)-3-(3-fluorophenoxy)-4-methyl-1-(pyridin-2-ylmethyl)piperidin-4-ol (PubChem CID 110145924) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is (3S,4S)-3-(3-fluorophenoxy)-4-methyl-1-(pyridin-2-ylmethyl)piperidin-4-ol.
| Compound Name | (3S,4S)-3-(3-fluorophenoxy)-4-methyl-1-(pyridin-2-ylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 110145924 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (3S,4S)-3-(3-fluorophenoxy)-4-methyl-1-(pyridin-2-ylmethyl)piperidin-4-ol |
| SMILES | C[C@]1(O)CCN(Cc2ccccn2)C[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C18H21FN2O2/c1-18(22)8-10-21(12-15-6-2-3-9-20-15)13-17(18)23-16-7-4-5-14(19)11-16/h2-7,9,11,17,22H,8,10,12-13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | XFJSSLQQCIHAQR-ROUUACIJSA-N |
| XLogP | 2.62 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |