About 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid
4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid (PubChem CID 110145954) has the molecular formula C16H20FNO5
and a molecular weight of 325.34 g/mol. Its IUPAC name is 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid |
| PubChem CID | 110145954 |
| Molecular Formula | C16H20FNO5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid |
| SMILES | C[C@]1(O)CCN(C(=O)CCC(=O)O)C[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C16H20FNO5/c1-16(22)7-8-18(14(19)5-6-15(20)21)10-13(16)23-12-4-2-3-11(17)9-12/h2-4,9,13,22H,5-8,10H2,1H3,(H,20,21)/t13-,16-/m0/s1 |
| InChIKey | QRICEAHAGOTEQO-BBRMVZONSA-N |
| XLogP | 1.42 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid?
The IUPAC name of 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid (CID 110145954) is 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid?
The canonical SMILES for 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid is C[C@]1(O)CCN(C(=O)CCC(=O)O)C[C@@H]1Oc1cccc(F)c1.
What is the InChIKey of 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid?
The InChIKey is QRICEAHAGOTEQO-BBRMVZONSA-N. The full InChI is InChI=1S/C16H20FNO5/c1-16(22)7-8-18(14(19)5-6-15(20)21)10-13(16)23-12-4-2-3-11(17)9-12/h2-4,9,13,22H,5-8,10H2,1H3,(H,20,21)/t13-,16-/m0/s1.
What are the key properties of 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid?
4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid has a molecular weight of 325.34 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-methylpiperidin-1-yl]-4-oxobutanoic acid is sourced from PubChem (CID 110145954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).