C24H31N3O3 — CID 110147478
N-[[(4S,4aR,7R,9aS)-4-hydroxy-2,2-dimethyl-7-phenyl-3,4,4a,5,6,8,9,9a-octahydrocyclohepta[b]pyran-7-yl]methyl]pyridazine-3-carboxamide (PubChem CID 110147478) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[[(4S,4aR,7R,9aS)-4-hydroxy-2,2-dimethyl-7-phenyl-3,4,4a,5,6,8,9,9a-octahydrocyclohepta[b]pyran-7-yl]methyl]pyridazine-3-carboxamide.
| Compound Name | N-[[(4S,4aR,7R,9aS)-4-hydroxy-2,2-dimethyl-7-phenyl-3,4,4a,5,6,8,9,9a-octahydrocyclohepta[b]pyran-7-yl]methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110147478 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[[(4S,4aR,7R,9aS)-4-hydroxy-2,2-dimethyl-7-phenyl-3,4,4a,5,6,8,9,9a-octahydrocyclohepta[b]pyran-7-yl]methyl]pyridazine-3-carboxamide |
| SMILES | CC1(C)C[C@H](O)[C@H]2CC[C@](CNC(=O)c3cccnn3)(c3ccccc3)CC[C@@H]2O1 |
| InChI | InChI=1S/C24H31N3O3/c1-23(2)15-20(28)18-10-12-24(13-11-21(18)30-23,17-7-4-3-5-8-17)16-25-22(29)19-9-6-14-26-27-19/h3-9,14,18,20-21,28H,10-13,15-16H2,1-2H3,(H,25,29)/t18-,20+,21+,24+/m1/s1 |
| InChIKey | JPHFOOYXWBCAPH-HBDUWURDSA-N |
| XLogP | 3.26 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |