C29H32N2O3 — CID 110157026
N-[[(2S,4S,4aR,7R,9aS)-4-hydroxy-2,7-diphenyl-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-7-yl]methyl]pyridine-2-carboxamide (PubChem CID 110157026) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[[(2S,4S,4aR,7R,9aS)-4-hydroxy-2,7-diphenyl-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-7-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[(2S,4S,4aR,7R,9aS)-4-hydroxy-2,7-diphenyl-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-7-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110157026 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[[(2S,4S,4aR,7R,9aS)-4-hydroxy-2,7-diphenyl-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-7-yl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NC[C@]1(c2ccccc2)CC[C@H]2[C@H](CC1)O[C@H](c1ccccc1)C[C@@H]2O)c1ccccn1 |
| InChI | InChI=1S/C29H32N2O3/c32-25-19-27(21-9-3-1-4-10-21)34-26-15-17-29(16-14-23(25)26,22-11-5-2-6-12-22)20-31-28(33)24-13-7-8-18-30-24/h1-13,18,23,25-27,32H,14-17,19-20H2,(H,31,33)/t23-,25+,26+,27+,29+/m1/s1 |
| InChIKey | KETJIFJOFDPJJL-BTLRSZHPSA-N |
| XLogP | 4.83 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |