C27H31N3O2 — CID 70829537
2-methoxy-N-[[1-phenyl-4-(pyridin-2-ylmethylamino)cyclohexyl]methyl]benzamide (PubChem CID 70829537) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-methoxy-N-[[1-phenyl-4-(pyridin-2-ylmethylamino)cyclohexyl]methyl]benzamide.
| Compound Name | 2-methoxy-N-[[1-phenyl-4-(pyridin-2-ylmethylamino)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 70829537 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-methoxy-N-[[1-phenyl-4-(pyridin-2-ylmethylamino)cyclohexyl]methyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(NCc2ccccn2)CC1 |
| InChI | InChI=1S/C27H31N3O2/c1-32-25-13-6-5-12-24(25)26(31)30-20-27(21-9-3-2-4-10-21)16-14-22(15-17-27)29-19-23-11-7-8-18-28-23/h2-13,18,22,29H,14-17,19-20H2,1H3,(H,30,31) |
| InChIKey | BJIZQBQYIROXSE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |