C28H37N7O6S — CID 58842327
N-[[4-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide (PubChem CID 58842327) has the molecular formula C28H37N7O6S and a molecular weight of 599.71 g/mol. Its IUPAC name is N-[[4-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 58842327 |
| Molecular Formula | C28H37N7O6S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | N-[[4-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
| SMILES | COc1nc(NCCNS(=O)(=O)NC2CCC(CNC(=O)c3ccccc3OC)(c3ccccc3)CC2)nc(OC)n1 |
| InChI | InChI=1S/C28H37N7O6S/c1-39-23-12-8-7-11-22(23)24(36)30-19-28(20-9-5-4-6-10-20)15-13-21(14-16-28)35-42(37,38)31-18-17-29-25-32-26(40-2)34-27(33-25)41-3/h4-12,21,31,35H,13-19H2,1-3H3,(H,30,36)(H,29,32,33,34) |
| InChIKey | WQNYKOWYTSRIAO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|