C28H37N3O6 — CID 20596182
propan-2-yl N-[2-[[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]oxycarbonylamino]ethyl]carbamate (PubChem CID 20596182) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is propan-2-yl N-[2-[[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]oxycarbonylamino]ethyl]carbamate.
| Compound Name | propan-2-yl N-[2-[[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]oxycarbonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 20596182 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | propan-2-yl N-[2-[[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]oxycarbonylamino]ethyl]carbamate |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(OC(=O)NCCNC(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C28H37N3O6/c1-20(2)36-26(33)29-17-18-30-27(34)37-22-13-15-28(16-14-22,21-9-5-4-6-10-21)19-31-25(32)23-11-7-8-12-24(23)35-3/h4-12,20,22H,13-19H2,1-3H3,(H,29,33)(H,30,34)(H,31,32) |
| InChIKey | WDBQTXKPCJESRH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|