C29H38N2O5 — CID 54069418
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(1-hydroxycyclohexyl)-N-methylcarbamate (PubChem CID 54069418) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(1-hydroxycyclohexyl)-N-methylcarbamate.
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(1-hydroxycyclohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 54069418 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(1-hydroxycyclohexyl)-N-methylcarbamate |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(OC(=O)N(C)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C29H38N2O5/c1-31(29(34)17-9-4-10-18-29)27(33)36-23-15-19-28(20-16-23,22-11-5-3-6-12-22)21-30-26(32)24-13-7-8-14-25(24)35-2/h3,5-8,11-14,23,34H,4,9-10,15-21H2,1-2H3,(H,30,32) |
| InChIKey | MFIHIJZMCGLUQT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|