C23H27NO4 — CID 54173169
[(1R,3S)-3-[[(2-methoxybenzoyl)amino]methyl]-3-phenylcyclohexyl] acetate (PubChem CID 54173169) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [(1R,3S)-3-[[(2-methoxybenzoyl)amino]methyl]-3-phenylcyclohexyl] acetate.
| Compound Name | [(1R,3S)-3-[[(2-methoxybenzoyl)amino]methyl]-3-phenylcyclohexyl] acetate |
|---|---|
| PubChem CID | 54173169 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [(1R,3S)-3-[[(2-methoxybenzoyl)amino]methyl]-3-phenylcyclohexyl] acetate |
| SMILES | COc1ccccc1C(=O)NC[C@@]1(c2ccccc2)CCC[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C23H27NO4/c1-17(25)28-19-11-8-14-23(15-19,18-9-4-3-5-10-18)16-24-22(26)20-12-6-7-13-21(20)27-2/h3-7,9-10,12-13,19H,8,11,14-16H2,1-2H3,(H,24,26)/t19-,23-/m1/s1 |
| InChIKey | OWLFMJKRRPKHCN-AUSIDOKSSA-N |
| XLogP | 3.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |