C27H36N2O5 — CID 20596159
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(4-methoxybutyl)carbamate (PubChem CID 20596159) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(4-methoxybutyl)carbamate.
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(4-methoxybutyl)carbamate |
|---|---|
| PubChem CID | 20596159 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-(4-methoxybutyl)carbamate |
| SMILES | COCCCCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2O5/c1-32-19-9-8-18-28-26(31)34-22-14-16-27(17-15-22,21-10-4-3-5-11-21)20-29-25(30)23-12-6-7-13-24(23)33-2/h3-7,10-13,22H,8-9,14-20H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | HJZBDVVVKLSTDU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|