C24H32N2O5S — CID 177371469
[4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] N-(3-methoxypropyl)carbamate (PubChem CID 177371469) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] N-(3-methoxypropyl)carbamate.
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 177371469 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] N-(3-methoxypropyl)carbamate |
| SMILES | COCCCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccsc2)CC1 |
| InChI | InChI=1S/C24H32N2O5S/c1-29-14-5-13-25-23(28)31-19-8-11-24(12-9-19,18-10-15-32-16-18)17-26-22(27)20-6-3-4-7-21(20)30-2/h3-4,6-7,10,15-16,19H,5,8-9,11-14,17H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | VLETWQYGJROPOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|