C23H29NO4S — CID 58842583
[4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] butanoate (PubChem CID 58842583) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] butanoate.
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] butanoate |
|---|---|
| PubChem CID | 58842583 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-thiophen-3-ylcyclohexyl] butanoate |
| SMILES | CCCC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccsc2)CC1 |
| InChI | InChI=1S/C23H29NO4S/c1-3-6-21(25)28-18-9-12-23(13-10-18,17-11-14-29-15-17)16-24-22(26)19-7-4-5-8-20(19)27-2/h4-5,7-8,11,14-15,18H,3,6,9-10,12-13,16H2,1-2H3,(H,24,26) |
| InChIKey | OVFANUXFRDXFBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |