C26H31N3O4 — CID 58842307
N-[[4-(4-ethyl-2,5-dioxoimidazolidin-1-yl)-1-phenylcyclohexyl]methyl]-2-methoxybenzamide (PubChem CID 58842307) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[[4-(4-ethyl-2,5-dioxoimidazolidin-1-yl)-1-phenylcyclohexyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-(4-ethyl-2,5-dioxoimidazolidin-1-yl)-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 58842307 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[[4-(4-ethyl-2,5-dioxoimidazolidin-1-yl)-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
| SMILES | CCC1NC(=O)N(C2CCC(CNC(=O)c3ccccc3OC)(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C26H31N3O4/c1-3-21-24(31)29(25(32)28-21)19-13-15-26(16-14-19,18-9-5-4-6-10-18)17-27-23(30)20-11-7-8-12-22(20)33-2/h4-12,19,21H,3,13-17H2,1-2H3,(H,27,30)(H,28,32) |
| InChIKey | LSDZLSKUHSSWGJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|