C26H34N2O3 — CID 89204009
[4-[[1-(2-methylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl] N-(3-hydroxypropyl)carbamate (PubChem CID 89204009) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is [4-[[1-(2-methylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl] N-(3-hydroxypropyl)carbamate.
| Compound Name | [4-[[1-(2-methylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl] N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 89204009 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [4-[[1-(2-methylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl] N-(3-hydroxypropyl)carbamate |
| SMILES | C=C(NCC1(c2ccccc2)CCC(OC(=O)NCCCO)CC1)c1ccccc1C |
| InChI | InChI=1S/C26H34N2O3/c1-20-9-6-7-12-24(20)21(2)28-19-26(22-10-4-3-5-11-22)15-13-23(14-16-26)31-25(30)27-17-8-18-29/h3-7,9-12,23,28-29H,2,8,13-19H2,1H3,(H,27,30) |
| InChIKey | ZUMLHBNVYOVDAF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|