C27H32N4O — CID 142271448
N-[[4-[1-amino-1-(2H-azirin-3-ylimino)but-3-en-2-yl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide (PubChem CID 142271448) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[[4-[1-amino-1-(2H-azirin-3-ylimino)but-3-en-2-yl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide.
| Compound Name | N-[[4-[1-amino-1-(2H-azirin-3-ylimino)but-3-en-2-yl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 142271448 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[[4-[1-amino-1-(2H-azirin-3-ylimino)but-3-en-2-yl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide |
| SMILES | C=CC(/C(N)=N/C1=NC1)C1CCC(CNC(=O)c2ccccc2C)(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O/c1-3-22(25(28)31-24-17-29-24)20-13-15-27(16-14-20,21-10-5-4-6-11-21)18-30-26(32)23-12-8-7-9-19(23)2/h3-12,20,22H,1,13-18H2,2H3,(H,30,32)(H2,28,29,31) |
| InChIKey | CPVKIGBIQVDYJN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|