C26H32N2O4 — CID 18009457
prop-2-enyl N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]-N-methylcarbamate (PubChem CID 18009457) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is prop-2-enyl N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]-N-methylcarbamate.
| Compound Name | prop-2-enyl N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 18009457 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | prop-2-enyl N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]-N-methylcarbamate |
| SMILES | C=CCOC(=O)N(C)C1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N2O4/c1-4-18-32-25(30)28(2)21-14-16-26(17-15-21,20-10-6-5-7-11-20)19-27-24(29)22-12-8-9-13-23(22)31-3/h4-13,21H,1,14-19H2,2-3H3,(H,27,29) |
| InChIKey | JLEIKWRBTCPPSQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|