C26H33N5O4 — CID 18449663
N-[[4-[(N'-cyanocarbamimidoyl)-methylamino]-1-phenylcyclohexyl]methyl]-2,4,5-trimethoxybenzamide (PubChem CID 18449663) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[[4-[(N'-cyanocarbamimidoyl)-methylamino]-1-phenylcyclohexyl]methyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-[(N'-cyanocarbamimidoyl)-methylamino]-1-phenylcyclohexyl]methyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 18449663 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-[[4-[(N'-cyanocarbamimidoyl)-methylamino]-1-phenylcyclohexyl]methyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCC2(c3ccccc3)CCC(N(C)/C(N)=N/C#N)CC2)cc1OC |
| InChI | InChI=1S/C26H33N5O4/c1-31(25(28)30-17-27)19-10-12-26(13-11-19,18-8-6-5-7-9-18)16-29-24(32)20-14-22(34-3)23(35-4)15-21(20)33-2/h5-9,14-15,19H,10-13,16H2,1-4H3,(H2,28,30)(H,29,32) |
| InChIKey | JLGGRYXZJQKYAV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|