C28H28N4O3 — CID 89126629
phenyl N-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidine-1-carboximidate (PubChem CID 89126629) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is phenyl N-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidine-1-carboximidate.
| Compound Name | phenyl N-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidine-1-carboximidate |
|---|---|
| PubChem CID | 89126629 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | phenyl N-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidine-1-carboximidate |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCN(/C(=N\C#N)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C28H28N4O3/c1-34-25-15-9-8-14-24(25)26(33)30-20-28(22-10-4-2-5-11-22)16-18-32(19-17-28)27(31-21-29)35-23-12-6-3-7-13-23/h2-15H,16-20H2,1H3,(H,30,33)/b31-27+ |
| InChIKey | KUWDILBLMPLCRJ-TVKQRKNISA-N |
| XLogP | 4.37 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|