C23H31N3O5S — CID 22241040
N-[[1-(1-hydroxypropan-2-ylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 22241040) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is N-[[1-(1-hydroxypropan-2-ylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[1-(1-hydroxypropan-2-ylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 22241040 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[[1-(1-hydroxypropan-2-ylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCN(S(=O)(=O)NC(C)CO)CC1 |
| InChI | InChI=1S/C23H31N3O5S/c1-18(16-27)25-32(29,30)26-14-12-23(13-15-26,19-8-4-3-5-9-19)17-24-22(28)20-10-6-7-11-21(20)31-2/h3-11,18,25,27H,12-17H2,1-2H3,(H,24,28) |
| InChIKey | NBTLPJDSMXNXQO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |