C28H33N3O5S — CID 143258720
2-methoxy-N-[[1-[[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]sulfamoyl]-4-phenylpiperidin-4-yl]methyl]benzamide (PubChem CID 143258720) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]sulfamoyl]-4-phenylpiperidin-4-yl]methyl]benzamide.
| Compound Name | 2-methoxy-N-[[1-[[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]sulfamoyl]-4-phenylpiperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 143258720 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-methoxy-N-[[1-[[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]sulfamoyl]-4-phenylpiperidin-4-yl]methyl]benzamide |
| SMILES | C=C/C=C\C=C(/C)C(=O)NS(=O)(=O)N1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N3O5S/c1-4-5-7-12-22(2)26(32)30-37(34,35)31-19-17-28(18-20-31,23-13-8-6-9-14-23)21-29-27(33)24-15-10-11-16-25(24)36-3/h4-16H,1,17-21H2,2-3H3,(H,29,33)(H,30,32)/b7-5-,22-12+ |
| InChIKey | FGLKPDKWALLNOQ-TUAOZADDSA-N |
| XLogP | 3.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|