C20H24ClN3O4S — CID 22241034
5-chloro-2-methoxy-N-[(4-phenyl-1-sulfamoylpiperidin-4-yl)methyl]benzamide (PubChem CID 22241034) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(4-phenyl-1-sulfamoylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(4-phenyl-1-sulfamoylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 22241034 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(4-phenyl-1-sulfamoylpiperidin-4-yl)methyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCC1(c2ccccc2)CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C20H24ClN3O4S/c1-28-18-8-7-16(21)13-17(18)19(25)23-14-20(15-5-3-2-4-6-15)9-11-24(12-10-20)29(22,26)27/h2-8,13H,9-12,14H2,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | MDHHCWJEIIENDN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |