C28H39N3O5S — CID 142271452
acetylene;2-methoxy-N-[(1-phenylcyclohexyl)methyl]benzamide;N-methylmorpholine-4-sulfonamide (PubChem CID 142271452) has the molecular formula C28H39N3O5S and a molecular weight of 529.70 g/mol. Its IUPAC name is acetylene;2-methoxy-N-[(1-phenylcyclohexyl)methyl]benzamide;N-methylmorpholine-4-sulfonamide.
| Compound Name | acetylene;2-methoxy-N-[(1-phenylcyclohexyl)methyl]benzamide;N-methylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 142271452 |
| Molecular Formula | C28H39N3O5S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | acetylene;2-methoxy-N-[(1-phenylcyclohexyl)methyl]benzamide;N-methylmorpholine-4-sulfonamide |
| SMILES | C#C.CNS(=O)(=O)N1CCOCC1.COc1ccccc1C(=O)NCC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H25NO2.C5H12N2O3S.C2H2/c1-24-19-13-7-6-12-18(19)20(23)22-16-21(14-8-3-9-15-21)17-10-4-2-5-11-17;1-6-11(8,9)7-2-4-10-5-3-7;1-2/h2,4-7,10-13H,3,8-9,14-16H2,1H3,(H,22,23);6H,2-5H2,1H3;1-2H |
| InChIKey | LMKHWWJNVGVSOL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|