C25H32N4O4S — CID 23600905
N-[[1-(N'-cyclopropyl-N-methylsulfonylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 23600905) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[[1-(N'-cyclopropyl-N-methylsulfonylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[1-(N'-cyclopropyl-N-methylsulfonylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 23600905 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[[1-(N'-cyclopropyl-N-methylsulfonylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCN(/C(=N/C2CC2)NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C25H32N4O4S/c1-33-22-11-7-6-10-21(22)23(30)26-18-25(19-8-4-3-5-9-19)14-16-29(17-15-25)24(27-20-12-13-20)28-34(2,31)32/h3-11,20H,12-18H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | KRHJUSMVYJFEJM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|