C26H31N5O2 — CID 58842452
N-[[4-[[(cyanoamino)-(cyclopropylamino)methylidene]amino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide (PubChem CID 58842452) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[[4-[[(cyanoamino)-(cyclopropylamino)methylidene]amino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-[[(cyanoamino)-(cyclopropylamino)methylidene]amino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 58842452 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[[4-[[(cyanoamino)-(cyclopropylamino)methylidene]amino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(/N=C(\NC#N)NC2CC2)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-33-23-10-6-5-9-22(23)24(32)28-17-26(19-7-3-2-4-8-19)15-13-21(14-16-26)31-25(29-18-27)30-20-11-12-20/h2-10,20-21H,11-17H2,1H3,(H,28,32)(H2,29,30,31) |
| InChIKey | IMWHWNQPERSKJF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|