C32H38N4O4 — CID 58842525
ethyl N-[N'-benzyl-N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamimidoyl]carbamate (PubChem CID 58842525) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is ethyl N-[N'-benzyl-N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamimidoyl]carbamate.
| Compound Name | ethyl N-[N'-benzyl-N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 58842525 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | ethyl N-[N'-benzyl-N-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\Cc1ccccc1)NC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N4O4/c1-3-40-31(38)36-30(33-22-24-12-6-4-7-13-24)35-26-18-20-32(21-19-26,25-14-8-5-9-15-25)23-34-29(37)27-16-10-11-17-28(27)39-2/h4-17,26H,3,18-23H2,1-2H3,(H,34,37)(H2,33,35,36,38) |
| InChIKey | DOXFJJXGFQNZEO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|