C24H29N5O3 — CID 23600873
N-[[1-[N-cyano-N'-(2-hydroxyethyl)carbamimidoyl]-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 23600873) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[[1-[N-cyano-N'-(2-hydroxyethyl)carbamimidoyl]-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[1-[N-cyano-N'-(2-hydroxyethyl)carbamimidoyl]-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 23600873 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[[1-[N-cyano-N'-(2-hydroxyethyl)carbamimidoyl]-4-phenylpiperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCN(/C(=N/CCO)NC#N)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-32-21-10-6-5-9-20(21)22(31)27-17-24(19-7-3-2-4-8-19)11-14-29(15-12-24)23(28-18-25)26-13-16-30/h2-10,30H,11-17H2,1H3,(H,26,28)(H,27,31) |
| InChIKey | CAWPWFUQXCGLHI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|