C29H41N5O4 — CID 89148824
tert-butyl N-[3-[[amino-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidin-1-yl]methylidene]amino]propyl]carbamate (PubChem CID 89148824) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidin-1-yl]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[amino-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidin-1-yl]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 89148824 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | tert-butyl N-[3-[[amino-[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylpiperidin-1-yl]methylidene]amino]propyl]carbamate |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCN(/C(N)=N/CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H41N5O4/c1-28(2,3)38-27(36)32-18-10-17-31-26(30)34-19-15-29(16-20-34,22-11-6-5-7-12-22)21-33-25(35)23-13-8-9-14-24(23)37-4/h5-9,11-14H,10,15-21H2,1-4H3,(H2,30,31)(H,32,36)(H,33,35) |
| InChIKey | QHJPVASKGNNHLR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|