C23H25F2N5O — CID 23600893
N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-3,5-difluorobenzamide (PubChem CID 23600893) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-3,5-difluorobenzamide.
| Compound Name | N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 23600893 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]-3,5-difluorobenzamide |
| SMILES | CC/N=C(\NC#N)N1CCC(CNC(=O)c2cc(F)cc(F)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25F2N5O/c1-2-27-22(29-16-26)30-10-8-23(9-11-30,18-6-4-3-5-7-18)15-28-21(31)17-12-19(24)14-20(25)13-17/h3-7,12-14H,2,8-11,15H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | BAWYDCIRODLEFF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|