C25H32FN5O2 — CID 142821663
(2E,4Z)-N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-(3-fluorophenyl)piperidin-4-yl]methyl]-2-(1-methoxyethenyl)hexa-2,4-dienamide (PubChem CID 142821663) has the molecular formula C25H32FN5O2 and a molecular weight of 453.56 g/mol. Its IUPAC name is (2E,4Z)-N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-(3-fluorophenyl)piperidin-4-yl]methyl]-2-(1-methoxyethenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-(3-fluorophenyl)piperidin-4-yl]methyl]-2-(1-methoxyethenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 142821663 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | (2E,4Z)-N-[[1-(N-cyano-N'-ethylcarbamimidoyl)-4-(3-fluorophenyl)piperidin-4-yl]methyl]-2-(1-methoxyethenyl)hexa-2,4-dienamide |
| SMILES | C=C(OC)/C(=C\C=C/C)C(=O)NCC1(c2cccc(F)c2)CCN(/C(=N/CC)NC#N)CC1 |
| InChI | InChI=1S/C25H32FN5O2/c1-5-7-11-22(19(3)33-4)23(32)29-17-25(20-9-8-10-21(26)16-20)12-14-31(15-13-25)24(28-6-2)30-18-27/h5,7-11,16H,3,6,12-15,17H2,1-2,4H3,(H,28,30)(H,29,32)/b7-5-,22-11+ |
| InChIKey | HJINIKKJYDYHDF-BCJWTHBWSA-N |
| XLogP | 3.38 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|