C24H31N5O4S — CID 23601053
N-cyano-4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]-N'-ethyl-4-phenylpiperidine-1-carboximidamide (PubChem CID 23601053) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-cyano-4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]-N'-ethyl-4-phenylpiperidine-1-carboximidamide.
| Compound Name | N-cyano-4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]-N'-ethyl-4-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 23601053 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-cyano-4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]-N'-ethyl-4-phenylpiperidine-1-carboximidamide |
| SMILES | CC/N=C(\NC#N)N1CCC(CNS(=O)(=O)c2cc(OC)ccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N5O4S/c1-4-26-23(27-18-25)29-14-12-24(13-15-29,19-8-6-5-7-9-19)17-28-34(30,31)22-16-20(32-2)10-11-21(22)33-3/h5-11,16,28H,4,12-15,17H2,1-3H3,(H,26,27) |
| InChIKey | QWRQHQVNRUMNOE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|