C25H37N3O3 — CID 142821449
formaldehyde;(2E)-2-(1-methoxyethenyl)-N-[[1-[methyl(propan-2-yl)amino]-4-phenylpiperidin-4-yl]methyl]penta-2,4-dienamide (PubChem CID 142821449) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is formaldehyde;(2E)-2-(1-methoxyethenyl)-N-[[1-[methyl(propan-2-yl)amino]-4-phenylpiperidin-4-yl]methyl]penta-2,4-dienamide.
| Compound Name | formaldehyde;(2E)-2-(1-methoxyethenyl)-N-[[1-[methyl(propan-2-yl)amino]-4-phenylpiperidin-4-yl]methyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 142821449 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | formaldehyde;(2E)-2-(1-methoxyethenyl)-N-[[1-[methyl(propan-2-yl)amino]-4-phenylpiperidin-4-yl]methyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C(=C)OC)C(=O)NCC1(c2ccccc2)CCN(N(C)C(C)C)CC1.C=O |
| InChI | InChI=1S/C24H35N3O2.CH2O/c1-7-11-22(20(4)29-6)23(28)25-18-24(21-12-9-8-10-13-21)14-16-27(17-15-24)26(5)19(2)3;1-2/h7-13,19H,1,4,14-18H2,2-3,5-6H3,(H,25,28);1H2/b22-11+; |
| InChIKey | QQCLGDBTKKSRIG-RCIYGFKVSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|