C24H30N6O3 — CID 58842728
N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2,6-dimethoxypyridine-3-carboxamide (PubChem CID 58842728) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2,6-dimethoxypyridine-3-carboxamide.
| Compound Name | N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2,6-dimethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 58842728 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2,6-dimethoxypyridine-3-carboxamide |
| SMILES | C/N=C(\NC#N)NC1CCC(CNC(=O)c2ccc(OC)nc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N6O3/c1-26-23(28-16-25)29-18-11-13-24(14-12-18,17-7-5-4-6-8-17)15-27-21(31)19-9-10-20(32-2)30-22(19)33-3/h4-10,18H,11-15H2,1-3H3,(H,27,31)(H2,26,28,29) |
| InChIKey | HMGMWOUIPLEQMZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|