C23H27N5O2 — CID 58842784
(E)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(furan-3-yl)prop-2-enamide (PubChem CID 58842784) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(furan-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(furan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58842784 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (E)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(furan-3-yl)prop-2-enamide |
| SMILES | C/N=C(\NC#N)NC1CCC(CNC(=O)/C=C/c2ccoc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N5O2/c1-25-22(27-17-24)28-20-9-12-23(13-10-20,19-5-3-2-4-6-19)16-26-21(29)8-7-18-11-14-30-15-18/h2-8,11,14-15,20H,9-10,12-13,16H2,1H3,(H,26,29)(H2,25,27,28)/b8-7+ |
| InChIKey | FLTCCEGZNYEXDV-BQYQJAHWSA-N |
| XLogP | 2.94 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|