C19H27N5O3S — CID 58842686
N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2-methylsulfonylacetamide (PubChem CID 58842686) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2-methylsulfonylacetamide.
| Compound Name | N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 58842686 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-2-methylsulfonylacetamide |
| SMILES | C/N=C(\NC#N)NC1CCC(CNC(=O)CS(C)(=O)=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N5O3S/c1-21-18(23-14-20)24-16-8-10-19(11-9-16,15-6-4-3-5-7-15)13-22-17(25)12-28(2,26)27/h3-7,16H,8-13H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | SVPPAUOLWONRFN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|