C28H29ClN6O2 — CID 58842799
2-(4-chlorophenoxy)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]pyridine-3-carboxamide (PubChem CID 58842799) has the molecular formula C28H29ClN6O2 and a molecular weight of 517.03 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58842799 |
| Molecular Formula | C28H29ClN6O2 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]pyridine-3-carboxamide |
| SMILES | C/N=C(\NC#N)NC1CCC(CNC(=O)c2cccnc2Oc2ccc(Cl)cc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H29ClN6O2/c1-31-27(34-19-30)35-22-13-15-28(16-14-22,20-6-3-2-4-7-20)18-33-25(36)24-8-5-17-32-26(24)37-23-11-9-21(29)10-12-23/h2-12,17,22H,13-16,18H2,1H3,(H,33,36)(H2,31,34,35) |
| InChIKey | DUZAFDMXLSQEIC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|