C24H29IN6O — CID 89353808
2-amino-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(iodomethyl)benzamide (PubChem CID 89353808) has the molecular formula C24H29IN6O and a molecular weight of 544.44 g/mol. Its IUPAC name is 2-amino-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(iodomethyl)benzamide.
| Compound Name | 2-amino-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(iodomethyl)benzamide |
|---|---|
| PubChem CID | 89353808 |
| Molecular Formula | C24H29IN6O |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-amino-N-[[4-[(N-cyano-N'-methylcarbamimidoyl)amino]-1-phenylcyclohexyl]methyl]-3-(iodomethyl)benzamide |
| SMILES | C/N=C(\NC#N)NC1CCC(CNC(=O)c2cccc(CI)c2N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29IN6O/c1-28-23(30-16-26)31-19-10-12-24(13-11-19,18-7-3-2-4-8-18)15-29-22(32)20-9-5-6-17(14-25)21(20)27/h2-9,19H,10-15,27H2,1H3,(H,29,32)(H2,28,30,31) |
| InChIKey | WPGKKOZQOBRZPD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|