C28H27FN4O3 — CID 23600859
phenyl N-cyano-4-(2-fluorophenyl)-4-[[(2-methoxybenzoyl)amino]methyl]piperidine-1-carboximidate (PubChem CID 23600859) has the molecular formula C28H27FN4O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is phenyl N-cyano-4-(2-fluorophenyl)-4-[[(2-methoxybenzoyl)amino]methyl]piperidine-1-carboximidate.
| Compound Name | phenyl N-cyano-4-(2-fluorophenyl)-4-[[(2-methoxybenzoyl)amino]methyl]piperidine-1-carboximidate |
|---|---|
| PubChem CID | 23600859 |
| Molecular Formula | C28H27FN4O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | phenyl N-cyano-4-(2-fluorophenyl)-4-[[(2-methoxybenzoyl)amino]methyl]piperidine-1-carboximidate |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2F)CCN(/C(=N\C#N)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27FN4O3/c1-35-25-14-8-5-11-22(25)26(34)31-19-28(23-12-6-7-13-24(23)29)15-17-33(18-16-28)27(32-20-30)36-21-9-3-2-4-10-21/h2-14H,15-19H2,1H3,(H,31,34)/b32-27+ |
| InChIKey | WFHCCEAKQOLGMT-QVAGMWBUSA-N |
| XLogP | 4.51 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|