C26H29N3O4 — CID 18009450
prop-2-enyl N-[1-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamate (PubChem CID 18009450) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is prop-2-enyl N-[1-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamate.
| Compound Name | prop-2-enyl N-[1-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 18009450 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | prop-2-enyl N-[1-cyano-4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl]carbamate |
| SMILES | C=CCOC(=O)NC1(C#N)CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O4/c1-3-17-33-24(31)29-26(18-27)15-13-25(14-16-26,20-9-5-4-6-10-20)19-28-23(30)21-11-7-8-12-22(21)32-2/h3-12H,1,13-17,19H2,2H3,(H,28,30)(H,29,31) |
| InChIKey | IHEDYFIYBRCFJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|