C28H43N3O2 — CID 142271283
ethane;N-[[4-[2-(1-methoxybutan-2-yl)hydrazinyl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide (PubChem CID 142271283) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is ethane;N-[[4-[2-(1-methoxybutan-2-yl)hydrazinyl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide.
| Compound Name | ethane;N-[[4-[2-(1-methoxybutan-2-yl)hydrazinyl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 142271283 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | ethane;N-[[4-[2-(1-methoxybutan-2-yl)hydrazinyl]-1-phenylcyclohexyl]methyl]-2-methylbenzamide |
| SMILES | CC.CCC(COC)NNC1CCC(CNC(=O)c2ccccc2C)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H37N3O2.C2H6/c1-4-22(18-31-3)28-29-23-14-16-26(17-15-23,21-11-6-5-7-12-21)19-27-25(30)24-13-9-8-10-20(24)2;1-2/h5-13,22-23,28-29H,4,14-19H2,1-3H3,(H,27,30);1-2H3 |
| InChIKey | NDQUXAHFDNAELP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|