C27H40N4 — CID 142271242
N'-[4-[[1-(2-ethylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl]methanimidamide;N-methylethanamine (PubChem CID 142271242) has the molecular formula C27H40N4 and a molecular weight of 420.65 g/mol. Its IUPAC name is N'-[4-[[1-(2-ethylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl]methanimidamide;N-methylethanamine.
| Compound Name | N'-[4-[[1-(2-ethylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl]methanimidamide;N-methylethanamine |
|---|---|
| PubChem CID | 142271242 |
| Molecular Formula | C27H40N4 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | N'-[4-[[1-(2-ethylphenyl)ethenylamino]methyl]-4-phenylcyclohexyl]methanimidamide;N-methylethanamine |
| SMILES | C=C(NCC1(c2ccccc2)CCC(/N=C/N)CC1)c1ccccc1CC.CCNC |
| InChI | InChI=1S/C24H31N3.C3H9N/c1-3-20-9-7-8-12-23(20)19(2)26-17-24(21-10-5-4-6-11-21)15-13-22(14-16-24)27-18-25;1-3-4-2/h4-12,18,22,26H,2-3,13-17H2,1H3,(H2,25,27);4H,3H2,1-2H3 |
| InChIKey | DWHWNSRQMFQEQE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|