C27H33BrN6O4S — CID 58842646
N-[[4-[2-[(5-bromopyrimidin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide (PubChem CID 58842646) has the molecular formula C27H33BrN6O4S and a molecular weight of 617.57 g/mol. Its IUPAC name is N-[[4-[2-[(5-bromopyrimidin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-[2-[(5-bromopyrimidin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 58842646 |
| Molecular Formula | C27H33BrN6O4S |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | N-[[4-[2-[(5-bromopyrimidin-2-yl)amino]ethylsulfamoylamino]-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(NS(=O)(=O)NCCNc2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C27H33BrN6O4S/c1-38-24-10-6-5-9-23(24)25(35)32-19-27(20-7-3-2-4-8-20)13-11-22(12-14-27)34-39(36,37)33-16-15-29-26-30-17-21(28)18-31-26/h2-10,17-18,22,33-34H,11-16,19H2,1H3,(H,32,35)(H,29,30,31) |
| InChIKey | MGEHWCNVURMCBB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|