C22H24F2N2O2 — CID 110148336
2-[(3S,3aR,7aR)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-N-(3-fluoro-2-methylphenyl)acetamide (PubChem CID 110148336) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-[(3S,3aR,7aR)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-N-(3-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-[(3S,3aR,7aR)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-N-(3-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110148336 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[(3S,3aR,7aR)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-N-(3-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1c(F)cccc1NC(=O)CN1C[C@H](c2ccc(F)cc2)[C@H]2COCC[C@H]21 |
| InChI | InChI=1S/C22H24F2N2O2/c1-14-19(24)3-2-4-20(14)25-22(27)12-26-11-17(15-5-7-16(23)8-6-15)18-13-28-10-9-21(18)26/h2-8,17-18,21H,9-13H2,1H3,(H,25,27)/t17-,18-,21-/m1/s1 |
| InChIKey | VNTCVEJTOHYKLV-DBXWQHBBSA-N |
| XLogP | 3.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |