C16H24FN3O — CID 119920472
N-(3-fluoro-2-methylphenyl)-3-[3-(methylamino)piperidin-1-yl]propanamide (PubChem CID 119920472) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-3-[3-(methylamino)piperidin-1-yl]propanamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-3-[3-(methylamino)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 119920472 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-3-[3-(methylamino)piperidin-1-yl]propanamide |
| SMILES | CNC1CCCN(CCC(=O)Nc2cccc(F)c2C)C1 |
| InChI | InChI=1S/C16H24FN3O/c1-12-14(17)6-3-7-15(12)19-16(21)8-10-20-9-4-5-13(11-20)18-2/h3,6-7,13,18H,4-5,8-11H2,1-2H3,(H,19,21) |
| InChIKey | QCDKYMXQGRMYKL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |