C16H25ClN4O3 — CID 119919127
3-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-3-nitrophenyl)propanamide;hydrochloride (PubChem CID 119919127) has the molecular formula C16H25ClN4O3 and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-3-nitrophenyl)propanamide;hydrochloride.
| Compound Name | 3-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-3-nitrophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119919127 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-3-nitrophenyl)propanamide;hydrochloride |
| SMILES | CNC1CCCN(CCC(=O)Nc2cccc([N+](=O)[O-])c2C)C1.Cl |
| InChI | InChI=1S/C16H24N4O3.ClH/c1-12-14(6-3-7-15(12)20(22)23)18-16(21)8-10-19-9-4-5-13(11-19)17-2;/h3,6-7,13,17H,4-5,8-11H2,1-2H3,(H,18,21);1H |
| InChIKey | FDDIAZJMDJMFGI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|