C17H31O7PSi — CID 11015010
(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one (PubChem CID 11015010) has the molecular formula C17H31O7PSi and a molecular weight of 406.49 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 11015010 |
| Molecular Formula | C17H31O7PSi |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
| SMILES | COP(=O)(OC)C1=C[C@H]2OC(C)(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H31O7PSi/c1-16(2,3)26(8,9)24-15-13(18)12(25(19,20-6)21-7)10-11-14(15)23-17(4,5)22-11/h10-11,14-15H,1-9H3/t11-,14-,15-/m1/s1 |
| InChIKey | RHFFLDPJYZXQGZ-KCPJHIHWSA-N |
| XLogP | 3.85 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|