C18H30O4Si — CID 11002257
(3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one (PubChem CID 11002257) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one.
| Compound Name | (3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 11002257 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)C=C[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C18H30O4Si/c1-17(2,3)23(4,5)22-15-13(19)9-10-14-16(15)21-18(20-14)11-7-6-8-12-18/h9-10,14-16H,6-8,11-12H2,1-5H3/t14-,15-,16-/m0/s1 |
| InChIKey | BZTMRLIGMMZHJT-JYJNAYRXSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|