C19H34O4Si — CID 135024283
(2R,3aS,7aR)-7a-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-3a,4-dihydro-1,3-benzodioxol-5-one (PubChem CID 135024283) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is (2R,3aS,7aR)-7a-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-3a,4-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (2R,3aS,7aR)-7a-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-3a,4-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 135024283 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2R,3aS,7aR)-7a-methyl-2-[2-tri(propan-2-yl)silyloxyethyl]-3a,4-dihydro-1,3-benzodioxol-5-one |
| SMILES | CC(C)[Si](OCC[C@@H]1O[C@H]2CC(=O)C=C[C@@]2(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-13(2)24(14(3)4,15(5)6)21-11-9-18-22-17-12-16(20)8-10-19(17,7)23-18/h8,10,13-15,17-18H,9,11-12H2,1-7H3/t17-,18+,19+/m0/s1 |
| InChIKey | SCBJWFVVQAQHDJ-IPMKNSEASA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|