C15H26O4Si — CID 166438065
9-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]dec-6-en-8-one (PubChem CID 166438065) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]dec-6-en-8-one.
| Compound Name | 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]dec-6-en-8-one |
|---|---|
| PubChem CID | 166438065 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]dec-6-en-8-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC2(C=CC1=O)OCCO2 |
| InChI | InChI=1S/C15H26O4Si/c1-14(2,3)20(4,5)19-11-12-10-15(7-6-13(12)16)17-8-9-18-15/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | KKSZUQBGXMXPBT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|