C28H29N5O2 — CID 110150496
1-methyl-N-[2-[4-(quinolin-6-ylmethyl)azepane-1-carbonyl]phenyl]pyrazole-3-carboxamide (PubChem CID 110150496) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-methyl-N-[2-[4-(quinolin-6-ylmethyl)azepane-1-carbonyl]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-[2-[4-(quinolin-6-ylmethyl)azepane-1-carbonyl]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110150496 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 1-methyl-N-[2-[4-(quinolin-6-ylmethyl)azepane-1-carbonyl]phenyl]pyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccccc2C(=O)N2CCCC(Cc3ccc4ncccc4c3)CC2)n1 |
| InChI | InChI=1S/C28H29N5O2/c1-32-16-13-26(31-32)27(34)30-25-9-3-2-8-23(25)28(35)33-15-5-6-20(12-17-33)18-21-10-11-24-22(19-21)7-4-14-29-24/h2-4,7-11,13-14,16,19-20H,5-6,12,15,17-18H2,1H3,(H,30,34) |
| InChIKey | BSVONHXCHGSIKY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |